C25H37N5 — CID 163710732
3-[6-(6-pyrrolidin-1-yl-3a,6,7,7a-tetrahydro-1H-benzimidazol-2-yl)cyclohexen-1-yl]-1,2,3,4,4a,5,6,8a-octahydroquinoxaline (PubChem CID 163710732) has the molecular formula C25H37N5 and a molecular weight of 407.61 g/mol. Its IUPAC name is 3-[6-(6-pyrrolidin-1-yl-3a,6,7,7a-tetrahydro-1H-benzimidazol-2-yl)cyclohexen-1-yl]-1,2,3,4,4a,5,6,8a-octahydroquinoxaline.
| Compound Name | 3-[6-(6-pyrrolidin-1-yl-3a,6,7,7a-tetrahydro-1H-benzimidazol-2-yl)cyclohexen-1-yl]-1,2,3,4,4a,5,6,8a-octahydroquinoxaline |
|---|---|
| PubChem CID | 163710732 |
| Molecular Formula | C25H37N5 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | 3-[6-(6-pyrrolidin-1-yl-3a,6,7,7a-tetrahydro-1H-benzimidazol-2-yl)cyclohexen-1-yl]-1,2,3,4,4a,5,6,8a-octahydroquinoxaline |
| SMILES | C1=CC2NCC(C3=CCCCC3C3=NC4C=CC(N5CCCC5)CC4N3)NC2CC1 |
| InChI | InChI=1S/C25H37N5/c1-2-8-19(18(7-1)24-16-26-20-9-3-4-10-21(20)27-24)25-28-22-12-11-17(15-23(22)29-25)30-13-5-6-14-30/h3,7,9,11-12,17,19-24,26-27H,1-2,4-6,8,10,13-16H2,(H,28,29) |
| InChIKey | KIZIECWPZNHYIQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|