C12H14O6 — CID 163711275
methyl 6-acetyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylate (PubChem CID 163711275) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is methyl 6-acetyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylate.
| Compound Name | methyl 6-acetyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 163711275 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | methyl 6-acetyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylate |
| SMILES | COC(=O)C1CC2C(=O)OC(=O)C2CC1C(C)=O |
| InChI | InChI=1S/C12H14O6/c1-5(13)6-3-8-9(12(16)18-11(8)15)4-7(6)10(14)17-2/h6-9H,3-4H2,1-2H3 |
| InChIKey | KJKXUYIKFHWCGL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|