About ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane
ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane (PubChem CID 163711371) has the molecular formula C8H8IN3
and a molecular weight of 273.08 g/mol. Its IUPAC name is ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane.
Molecular Properties
| Compound Name | ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane |
| PubChem CID | 163711371 |
| Molecular Formula | C8H8IN3 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane |
| SMILES | C/C=I/n1cnc2cnccc21 |
| InChI | InChI=1S/C8H8IN3/c1-2-9-12-6-11-7-5-10-4-3-8(7)12/h2-6H,1H3 |
| InChIKey | KJMXIBVVWXYTBY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane?
The IUPAC name of ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane (CID 163711371) is ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane.
What is the SMILES notation for ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane?
The canonical SMILES for ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane is C/C=I/n1cnc2cnccc21.
What is the InChIKey of ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane?
The InChIKey is KJMXIBVVWXYTBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8IN3/c1-2-9-12-6-11-7-5-10-4-3-8(7)12/h2-6H,1H3.
What are the key properties of ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane?
ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane has a molecular weight of 273.08 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethylidene(imidazo[4,5-c]pyridin-1-yl)-λ3-iodane is sourced from PubChem (CID 163711371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).