methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate

C8H12F3NO2 — CID 163711525

IUPACmethyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate
SMILESCOC(=O)[C@H]1NCCC[C@H]1C(F)(F)F
InChIInChI=1S/C8H12F3NO2/c1-14-7(13)6-5(8(9,10)11)3-2-4-12-6/h5-6,12H,2-4H2,1H3/t5-,6+/m1/s1
InChIKeyKJQPPXYGGKXHEQ-RITPCOANSA-N
MW211.18 g/mol
LogP1.09
Rot. Bonds1

About methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate

methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate (PubChem CID 163711525) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate.

Molecular Properties

Compound Namemethyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate
PubChem CID163711525
Molecular FormulaC8H12F3NO2
Molecular Weight211.18 g/mol
Exact Mass211.08
IUPAC Namemethyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate
SMILESCOC(=O)[C@H]1NCCC[C@H]1C(F)(F)F
InChIInChI=1S/C8H12F3NO2/c1-14-7(13)6-5(8(9,10)11)3-2-4-12-6/h5-6,12H,2-4H2,1H3/t5-,6+/m1/s1
InChIKeyKJQPPXYGGKXHEQ-RITPCOANSA-N
XLogP1.09
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.18
LogP ≤ 51.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate?
The IUPAC name of methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate (CID 163711525) is methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate.
What is the SMILES notation for methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate?
The canonical SMILES for methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate is COC(=O)[C@H]1NCCC[C@H]1C(F)(F)F.
What is the InChIKey of methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate?
The InChIKey is KJQPPXYGGKXHEQ-RITPCOANSA-N. The full InChI is InChI=1S/C8H12F3NO2/c1-14-7(13)6-5(8(9,10)11)3-2-4-12-6/h5-6,12H,2-4H2,1H3/t5-,6+/m1/s1.
What are the key properties of methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate?
methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate has a molecular weight of 211.18 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3R)-3-(trifluoromethyl)piperidine-2-carboxylate is sourced from PubChem (CID 163711525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).