C22H26F3NO — CID 163711623
(Z)-N-[4-(2,4-dimethylcyclohexa-1,5-dien-1-yl)-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-2-methylidenehex-3-enamide (PubChem CID 163711623) has the molecular formula C22H26F3NO and a molecular weight of 377.45 g/mol. Its IUPAC name is (Z)-N-[4-(2,4-dimethylcyclohexa-1,5-dien-1-yl)-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-2-methylidenehex-3-enamide.
| Compound Name | (Z)-N-[4-(2,4-dimethylcyclohexa-1,5-dien-1-yl)-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-2-methylidenehex-3-enamide |
|---|---|
| PubChem CID | 163711623 |
| Molecular Formula | C22H26F3NO |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (Z)-N-[4-(2,4-dimethylcyclohexa-1,5-dien-1-yl)-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-2-methylidenehex-3-enamide |
| SMILES | C=C(/C=C\CC)C(=O)NC1=CC=C(C2=C(C)CC(C)C=C2)C(C(F)(F)F)C1 |
| InChI | InChI=1S/C22H26F3NO/c1-5-6-7-15(3)21(27)26-17-9-11-19(20(13-17)22(23,24)25)18-10-8-14(2)12-16(18)4/h6-11,14,20H,3,5,12-13H2,1-2,4H3,(H,26,27)/b7-6- |
| InChIKey | KJTDESATAMIZJJ-SREVYHEPSA-N |
| XLogP | 5.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|