C21H38O13 — CID 163711682
(2R,3R,4S,5S,6S)-2-ethyl-6-[(2R,3R,4R,5S,6S)-2-ethyl-6-[(2R,3R,4R,5S,6R)-2-ethyl-4,5,6-trihydroxyoxan-3-yl]oxy-4,5-dihydroxyoxan-3-yl]oxyoxane-3,4,5-triol (PubChem CID 163711682) has the molecular formula C21H38O13 and a molecular weight of 498.52 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-2-ethyl-6-[(2R,3R,4R,5S,6S)-2-ethyl-6-[(2R,3R,4R,5S,6R)-2-ethyl-4,5,6-trihydroxyoxan-3-yl]oxy-4,5-dihydroxyoxan-3-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6S)-2-ethyl-6-[(2R,3R,4R,5S,6S)-2-ethyl-6-[(2R,3R,4R,5S,6R)-2-ethyl-4,5,6-trihydroxyoxan-3-yl]oxy-4,5-dihydroxyoxan-3-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 163711682 |
| Molecular Formula | C21H38O13 |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | (2R,3R,4S,5S,6S)-2-ethyl-6-[(2R,3R,4R,5S,6S)-2-ethyl-6-[(2R,3R,4R,5S,6R)-2-ethyl-4,5,6-trihydroxyoxan-3-yl]oxy-4,5-dihydroxyoxan-3-yl]oxyoxane-3,4,5-triol |
| SMILES | CC[C@H]1O[C@@H](O[C@@H]2[C@H](O)[C@H](O)[C@H](O[C@@H]3[C@H](O)[C@H](O)[C@H](O)O[C@@H]3CC)O[C@@H]2CC)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H38O13/c1-4-7-10(22)11(23)15(27)20(31-7)34-18-9(6-3)32-21(16(28)13(18)25)33-17-8(5-2)30-19(29)14(26)12(17)24/h7-29H,4-6H2,1-3H3/t7-,8-,9-,10+,11+,12-,13-,14+,15+,16+,17+,18+,19-,20+,21+/m1/s1 |
| InChIKey | KJUKIJDPWDNOFW-SYQZAGGOSA-N |
| XLogP | -3.32 |
| TPSA | 207.99 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |