C20H38FN — CID 163711683
N-fluoro-1-[(2Z)-2-[(4S,6S)-2,3,4,5,6-pentamethyloctylidene]cyclobutyl]propan-1-amine (PubChem CID 163711683) has the molecular formula C20H38FN and a molecular weight of 311.53 g/mol. Its IUPAC name is N-fluoro-1-[(2Z)-2-[(4S,6S)-2,3,4,5,6-pentamethyloctylidene]cyclobutyl]propan-1-amine.
| Compound Name | N-fluoro-1-[(2Z)-2-[(4S,6S)-2,3,4,5,6-pentamethyloctylidene]cyclobutyl]propan-1-amine |
|---|---|
| PubChem CID | 163711683 |
| Molecular Formula | C20H38FN |
| Molecular Weight | 311.53 g/mol |
| Exact Mass | 311.30 |
| IUPAC Name | N-fluoro-1-[(2Z)-2-[(4S,6S)-2,3,4,5,6-pentamethyloctylidene]cyclobutyl]propan-1-amine |
| SMILES | CCC(NF)C1CC/C1=C/C(C)C(C)[C@@H](C)C(C)[C@@H](C)CC |
| InChI | InChI=1S/C20H38FN/c1-8-13(3)15(5)17(7)16(6)14(4)12-18-10-11-19(18)20(9-2)22-21/h12-17,19-20,22H,8-11H2,1-7H3/b18-12-/t13-,14?,15?,16?,17-,19?,20?/m0/s1 |
| InChIKey | KJUKOEJFFUFKLQ-BAAINJKNSA-N |
| XLogP | 6.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.53 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|