C24H32IN3O4 — CID 163711799
2-[[4-[5-[(2E,4E)-4,5-diethoxy-2-ethyl-5-iodopenta-2,4-dienyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]ethanol (PubChem CID 163711799) has the molecular formula C24H32IN3O4 and a molecular weight of 553.44 g/mol. Its IUPAC name is 2-[[4-[5-[(2E,4E)-4,5-diethoxy-2-ethyl-5-iodopenta-2,4-dienyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]ethanol.
| Compound Name | 2-[[4-[5-[(2E,4E)-4,5-diethoxy-2-ethyl-5-iodopenta-2,4-dienyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]ethanol |
|---|---|
| PubChem CID | 163711799 |
| Molecular Formula | C24H32IN3O4 |
| Molecular Weight | 553.44 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 2-[[4-[5-[(2E,4E)-4,5-diethoxy-2-ethyl-5-iodopenta-2,4-dienyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]ethanol |
| SMILES | CCO/C(I)=C(/C=C(\CC)Cc1nc(-c2cccc3c2CCC3NCCO)no1)OCC |
| InChI | InChI=1S/C24H32IN3O4/c1-4-16(14-21(30-5-2)23(25)31-6-3)15-22-27-24(28-32-22)19-9-7-8-18-17(19)10-11-20(18)26-12-13-29/h7-9,14,20,26,29H,4-6,10-13,15H2,1-3H3/b16-14+,23-21- |
| InChIKey | KJXKHUGAXSZVJT-WVRMCDPLSA-N |
| XLogP | 4.86 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|