C10H20N2 — CID 163712431
1-[(E)-1-amino-2,2-dimethylpent-3-enyl]cyclopropan-1-amine (PubChem CID 163712431) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-[(E)-1-amino-2,2-dimethylpent-3-enyl]cyclopropan-1-amine.
| Compound Name | 1-[(E)-1-amino-2,2-dimethylpent-3-enyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 163712431 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-[(E)-1-amino-2,2-dimethylpent-3-enyl]cyclopropan-1-amine |
| SMILES | C/C=C/C(C)(C)C(N)C1(N)CC1 |
| InChI | InChI=1S/C10H20N2/c1-4-5-9(2,3)8(11)10(12)6-7-10/h4-5,8H,6-7,11-12H2,1-3H3/b5-4+ |
| InChIKey | KKKSWINAXLSDKF-SNAWJCMRSA-N |
| XLogP | 1.41 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|