C45H68N4O3 — CID 163712438
1-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-1-[1-[[(5S)-5-methyl-6-(7-methylcyclotetradecyl)cyclononyl]methyl]indol-5-yl]urea (PubChem CID 163712438) has the molecular formula C45H68N4O3 and a molecular weight of 713.06 g/mol. Its IUPAC name is 1-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-1-[1-[[(5S)-5-methyl-6-(7-methylcyclotetradecyl)cyclononyl]methyl]indol-5-yl]urea.
| Compound Name | 1-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-1-[1-[[(5S)-5-methyl-6-(7-methylcyclotetradecyl)cyclononyl]methyl]indol-5-yl]urea |
|---|---|
| PubChem CID | 163712438 |
| Molecular Formula | C45H68N4O3 |
| Molecular Weight | 713.06 g/mol |
| Exact Mass | 712.53 |
| IUPAC Name | 1-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-1-[1-[[(5S)-5-methyl-6-(7-methylcyclotetradecyl)cyclononyl]methyl]indol-5-yl]urea |
| SMILES | [H]/N=C(\c1cc(C(C)C)c(O)cc1O)N(C(N)=O)c1ccc2c(ccn2CC2CCCC(C3CCCCCCCC(C)CCCCC3)[C@@H](C)CCC2)c1 |
| InChI | InChI=1S/C45H68N4O3/c1-31(2)39-28-40(43(51)29-42(39)50)44(46)49(45(47)52)37-23-24-41-36(27-37)25-26-48(41)30-34-18-13-17-33(4)38(22-14-19-34)35-20-11-7-5-6-9-15-32(3)16-10-8-12-21-35/h23-29,31-35,38,46,50-51H,5-22,30H2,1-4H3,(H2,47,52)/b46-44+/t32?,33-,34?,35?,38?/m0/s1 |
| InChIKey | KKKWJZFQIFXFIY-CPGCJUPVSA-N |
| XLogP | 12.26 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.06 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|