C23H40ClFO5 — CID 163712477
7-[(8S,9R)-3-(chloromethyl)-8-[(3S)-4-fluoro-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid (PubChem CID 163712477) has the molecular formula C23H40ClFO5 and a molecular weight of 451.02 g/mol. Its IUPAC name is 7-[(8S,9R)-3-(chloromethyl)-8-[(3S)-4-fluoro-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid.
| Compound Name | 7-[(8S,9R)-3-(chloromethyl)-8-[(3S)-4-fluoro-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
|---|---|
| PubChem CID | 163712477 |
| Molecular Formula | C23H40ClFO5 |
| Molecular Weight | 451.02 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 7-[(8S,9R)-3-(chloromethyl)-8-[(3S)-4-fluoro-3-hydroxyoctyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
| SMILES | CCCCC(F)[C@@H](O)CC[C@H]1CCC2(OCC(CCl)O2)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C23H40ClFO5/c1-2-3-9-20(25)21(26)12-11-17-13-14-23(29-16-18(15-24)30-23)19(17)8-6-4-5-7-10-22(27)28/h17-21,26H,2-16H2,1H3,(H,27,28)/t17-,18?,19+,20?,21-,23?/m0/s1 |
| InChIKey | KKMBYTOEZMLHGK-HXPFBKFNSA-N |
| XLogP | 5.46 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.02 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|