C32H44N5O2S+ — CID 163713575
2-[[4-cyano-2-[[2-(4,4-dimethylcyclohexen-1-yl)-4-[1-[(methylideneamino)methyl]cyclohexyl]phenyl]carbamoyl]imidazol-1-yl]methoxy]ethyl-dimethylsulfanium (PubChem CID 163713575) has the molecular formula C32H44N5O2S+ and a molecular weight of 562.80 g/mol. Its IUPAC name is 2-[[4-cyano-2-[[2-(4,4-dimethylcyclohexen-1-yl)-4-[1-[(methylideneamino)methyl]cyclohexyl]phenyl]carbamoyl]imidazol-1-yl]methoxy]ethyl-dimethylsulfanium.
| Compound Name | 2-[[4-cyano-2-[[2-(4,4-dimethylcyclohexen-1-yl)-4-[1-[(methylideneamino)methyl]cyclohexyl]phenyl]carbamoyl]imidazol-1-yl]methoxy]ethyl-dimethylsulfanium |
|---|---|
| PubChem CID | 163713575 |
| Molecular Formula | C32H44N5O2S+ |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | 2-[[4-cyano-2-[[2-(4,4-dimethylcyclohexen-1-yl)-4-[1-[(methylideneamino)methyl]cyclohexyl]phenyl]carbamoyl]imidazol-1-yl]methoxy]ethyl-dimethylsulfanium |
| SMILES | C=NCC1(c2ccc(NC(=O)c3nc(C#N)cn3COCC[S+](C)C)c(C3=CCC(C)(C)CC3)c2)CCCCC1 |
| InChI | InChI=1S/C32H43N5O2S/c1-31(2)15-11-24(12-16-31)27-19-25(32(22-34-3)13-7-6-8-14-32)9-10-28(27)36-30(38)29-35-26(20-33)21-37(29)23-39-17-18-40(4)5/h9-11,19,21H,3,6-8,12-18,22-23H2,1-2,4-5H3/p+1 |
| InChIKey | KLJSOECGDYPECR-UHFFFAOYSA-O |
| XLogP | 6.36 |
| TPSA | 92.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|