C18H24FN5OS — CID 163713998
N'-[1-[7-(4-fluorocyclohexa-1,5-diene-1-carbonyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl]ethylsulfanyl]ethanimidamide (PubChem CID 163713998) has the molecular formula C18H24FN5OS and a molecular weight of 377.49 g/mol. Its IUPAC name is N'-[1-[7-(4-fluorocyclohexa-1,5-diene-1-carbonyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl]ethylsulfanyl]ethanimidamide.
| Compound Name | N'-[1-[7-(4-fluorocyclohexa-1,5-diene-1-carbonyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl]ethylsulfanyl]ethanimidamide |
|---|---|
| PubChem CID | 163713998 |
| Molecular Formula | C18H24FN5OS |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N'-[1-[7-(4-fluorocyclohexa-1,5-diene-1-carbonyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl]ethylsulfanyl]ethanimidamide |
| SMILES | CC(N)=NSC(C)c1cnc2n1CCN(C(=O)C1=CCC(F)C=C1)C2C |
| InChI | InChI=1S/C18H24FN5OS/c1-11-17-21-10-16(12(2)26-22-13(3)20)24(17)9-8-23(11)18(25)14-4-6-15(19)7-5-14/h4-6,10-12,15H,7-9H2,1-3H3,(H2,20,22) |
| InChIKey | KLSOQLLNUZDASO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|