About 1-N',3-N'-diethyl-2-methylidenepropanediimidamide
1-N',3-N'-diethyl-2-methylidenepropanediimidamide (PubChem CID 163714430) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-N',3-N'-diethyl-2-methylidenepropanediimidamide.
Molecular Properties
| Compound Name | 1-N',3-N'-diethyl-2-methylidenepropanediimidamide |
| PubChem CID | 163714430 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 1-N',3-N'-diethyl-2-methylidenepropanediimidamide |
| SMILES | C=C(/C(N)=N/CC)/C(N)=N/CC |
| InChI | InChI=1S/C8H16N4/c1-4-11-7(9)6(3)8(10)12-5-2/h3-5H2,1-2H3,(H2,9,11)(H2,10,12) |
| InChIKey | KMCISXVJLKYXBQ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-N',3-N'-diethyl-2-methylidenepropanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N',3-N'-diethyl-2-methylidenepropanediimidamide?
The IUPAC name of 1-N',3-N'-diethyl-2-methylidenepropanediimidamide (CID 163714430) is 1-N',3-N'-diethyl-2-methylidenepropanediimidamide.
What is the SMILES notation for 1-N',3-N'-diethyl-2-methylidenepropanediimidamide?
The canonical SMILES for 1-N',3-N'-diethyl-2-methylidenepropanediimidamide is C=C(/C(N)=N/CC)/C(N)=N/CC.
What is the InChIKey of 1-N',3-N'-diethyl-2-methylidenepropanediimidamide?
The InChIKey is KMCISXVJLKYXBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-4-11-7(9)6(3)8(10)12-5-2/h3-5H2,1-2H3,(H2,9,11)(H2,10,12).
What are the key properties of 1-N',3-N'-diethyl-2-methylidenepropanediimidamide?
1-N',3-N'-diethyl-2-methylidenepropanediimidamide has a molecular weight of 168.24 g/mol, XLogP of 0.30, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N',3-N'-diethyl-2-methylidenepropanediimidamide is sourced from PubChem (CID 163714430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).