About 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one
2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one (PubChem CID 163715161) has the molecular formula C23H14N2O4
and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one |
| PubChem CID | 163715161 |
| Molecular Formula | C23H14N2O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(Cc2cccc(-c3nc4ccccc4c(=O)o3)c2)nc2ccccc12 |
| InChI | InChI=1S/C23H14N2O4/c26-22-16-8-1-3-10-18(16)24-20(28-22)13-14-6-5-7-15(12-14)21-25-19-11-4-2-9-17(19)23(27)29-21/h1-12H,13H2 |
| InChIKey | KMRWBFROQCKNCQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one?
The IUPAC name of 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one (CID 163715161) is 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one?
The canonical SMILES for 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one is O=c1oc(Cc2cccc(-c3nc4ccccc4c(=O)o3)c2)nc2ccccc12.
What is the InChIKey of 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one?
The InChIKey is KMRWBFROQCKNCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14N2O4/c26-22-16-8-1-3-10-18(16)24-20(28-22)13-14-6-5-7-15(12-14)21-25-19-11-4-2-9-17(19)23(27)29-21/h1-12H,13H2.
What are the key properties of 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one?
2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one has a molecular weight of 382.38 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methyl]-3,1-benzoxazin-4-one is sourced from PubChem (CID 163715161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).