C17H22F2O2 — CID 163715550
(6aR,10aS)-3-tert-butyl-6,6-difluoro-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol (PubChem CID 163715550) has the molecular formula C17H22F2O2 and a molecular weight of 296.36 g/mol. Its IUPAC name is (6aR,10aS)-3-tert-butyl-6,6-difluoro-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aR,10aS)-3-tert-butyl-6,6-difluoro-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 163715550 |
| Molecular Formula | C17H22F2O2 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (6aR,10aS)-3-tert-butyl-6,6-difluoro-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol |
| SMILES | CC(C)(C)c1cc(O)c2c(c1)OC(F)(F)[C@@H]1CCCC[C@H]21 |
| InChI | InChI=1S/C17H22F2O2/c1-16(2,3)10-8-13(20)15-11-6-4-5-7-12(11)17(18,19)21-14(15)9-10/h8-9,11-12,20H,4-7H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | KMZYRXIRLGJPQO-NWDGAFQWSA-N |
| XLogP | 4.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |