C34H40BFN3+ — CID 163716154
4-(2-fluoro-1,4,6,8,10,12-hexamethyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-4,6,10-trien-8-yl)-N-(6-methylcyclohexa-1,3-dien-1-yl)-N-phenylaniline (PubChem CID 163716154) has the molecular formula C34H40BFN3+ and a molecular weight of 520.53 g/mol. Its IUPAC name is 4-(2-fluoro-1,4,6,8,10,12-hexamethyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-4,6,10-trien-8-yl)-N-(6-methylcyclohexa-1,3-dien-1-yl)-N-phenylaniline.
| Compound Name | 4-(2-fluoro-1,4,6,8,10,12-hexamethyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-4,6,10-trien-8-yl)-N-(6-methylcyclohexa-1,3-dien-1-yl)-N-phenylaniline |
|---|---|
| PubChem CID | 163716154 |
| Molecular Formula | C34H40BFN3+ |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | 4-(2-fluoro-1,4,6,8,10,12-hexamethyl-3-aza-1-azonia-2-boratricyclo[7.3.0.03,7]dodeca-4,6,10-trien-8-yl)-N-(6-methylcyclohexa-1,3-dien-1-yl)-N-phenylaniline |
| SMILES | CC1=CC(C)[N+]2(C)B(F)n3c(C)cc(C)c3C(C)(c3ccc(N(C4=CC=CCC4C)c4ccccc4)cc3)C12 |
| InChI | InChI=1S/C34H40BFN3/c1-23-13-11-12-16-31(23)37(29-14-9-8-10-15-29)30-19-17-28(18-20-30)34(6)32-24(2)21-26(4)38(32)35(36)39(7)27(5)22-25(3)33(34)39/h8-12,14-23,27,33H,13H2,1-7H3/q+1 |
| InChIKey | DLAILTZQTABZIL-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|