C31H46N2O2 — CID 163716523
[3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-4-yl] (9Z,12Z)-heptadeca-9,12-dienoate (PubChem CID 163716523) has the molecular formula C31H46N2O2 and a molecular weight of 478.72 g/mol. Its IUPAC name is [3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-4-yl] (9Z,12Z)-heptadeca-9,12-dienoate.
| Compound Name | [3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-4-yl] (9Z,12Z)-heptadeca-9,12-dienoate |
|---|---|
| PubChem CID | 163716523 |
| Molecular Formula | C31H46N2O2 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | [3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-1H-indol-4-yl] (9Z,12Z)-heptadeca-9,12-dienoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCC(=O)Oc1cccc2[nH]cc(C[C@H]3CCCN3C)c12 |
| InChI | InChI=1S/C31H46N2O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-30(34)35-29-21-17-20-28-31(29)26(25-32-28)24-27-19-18-23-33(27)2/h6-7,9-10,17,20-21,25,27,32H,3-5,8,11-16,18-19,22-24H2,1-2H3/b7-6-,10-9-/t27-/m1/s1 |
| InChIKey | KNVUQBOOJFHZIJ-IQZSKYRKSA-N |
| XLogP | 8.13 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|