About methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate
methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 163716584) has the molecular formula C10H13NO4S
and a molecular weight of 243.28 g/mol. Its IUPAC name is methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 163716584 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC([N+](=O)[O-])=C(S)C(C)C1C |
| InChI | InChI=1S/C10H13NO4S/c1-5-6(2)9(16)8(11(13)14)4-7(5)10(12)15-3/h4-6,16H,1-3H3 |
| InChIKey | KNXFDKLPTUMZOA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate (CID 163716584) is methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate is COC(=O)C1=CC([N+](=O)[O-])=C(S)C(C)C1C.
What is the InChIKey of methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate?
The InChIKey is KNXFDKLPTUMZOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4S/c1-5-6(2)9(16)8(11(13)14)4-7(5)10(12)15-3/h4-6,16H,1-3H3.
What are the key properties of methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate?
methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate has a molecular weight of 243.28 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,6-dimethyl-3-nitro-4-sulfanylcyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 163716584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).