About CID 163717650
CID 163717650 (PubChem CID 163717650) has the molecular formula C8H11BO2
and a molecular weight of 149.99 g/mol.
Molecular Properties
| Compound Name | CID 163717650 |
| PubChem CID | 163717650 |
| Molecular Formula | C8H11BO2 |
| Molecular Weight | 149.99 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@H](O)C2(CC2O)C1=C |
| InChI | InChI=1S/C8H11BO2/c1-4-5(9)2-6(10)8(4)3-7(8)11/h5-7,10-11H,1-3H2/t5-,6-,7?,8?/m0/s1 |
| InChIKey | FNALAOISNWMATP-LHZZQDSXSA-N |
| XLogP | 0.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.99 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 163717650 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163717650?
The IUPAC name of CID 163717650 (CID 163717650) is not available.
What is the SMILES notation for CID 163717650?
The canonical SMILES for CID 163717650 is [B][C@H]1C[C@H](O)C2(CC2O)C1=C.
What is the InChIKey of CID 163717650?
The InChIKey is FNALAOISNWMATP-LHZZQDSXSA-N. The full InChI is InChI=1S/C8H11BO2/c1-4-5(9)2-6(10)8(4)3-7(8)11/h5-7,10-11H,1-3H2/t5-,6-,7?,8?/m0/s1.
What are the key properties of CID 163717650?
CID 163717650 has a molecular weight of 149.99 g/mol, XLogP of 0.02, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163717650 is sourced from PubChem (CID 163717650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).