About 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine
1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine (PubChem CID 163717805) has the molecular formula C26H53F2N3
and a molecular weight of 445.73 g/mol. Its IUPAC name is 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine.
Molecular Properties
| Compound Name | 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine |
| PubChem CID | 163717805 |
| Molecular Formula | C26H53F2N3 |
| Molecular Weight | 445.73 g/mol |
| Exact Mass | 445.42 |
| IUPAC Name | 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine |
| SMILES | CC(C)(C)N1CCC(F)(F)CC1.CC(C)(C)N1CCCC1.CC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C9H17F2N.C9H19N.C8H17N/c1-8(2,3)12-6-4-9(10,11)5-7-12;1-9(2,3)10-7-5-4-6-8-10;1-8(2,3)9-6-4-5-7-9/h4-7H2,1-3H3;4-8H2,1-3H3;4-7H2,1-3H3 |
| InChIKey | KOWTVAYIZPLRSJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.73 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine?
The IUPAC name of 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine (CID 163717805) is 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine.
What is the SMILES notation for 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine?
The canonical SMILES for 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine is CC(C)(C)N1CCC(F)(F)CC1.CC(C)(C)N1CCCC1.CC(C)(C)N1CCCCC1.
What is the InChIKey of 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine?
The InChIKey is KOWTVAYIZPLRSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2N.C9H19N.C8H17N/c1-8(2,3)12-6-4-9(10,11)5-7-12;1-9(2,3)10-7-5-4-6-8-10;1-8(2,3)9-6-4-5-7-9/h4-7H2,1-3H3;4-8H2,1-3H3;4-7H2,1-3H3.
What are the key properties of 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine?
1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine has a molecular weight of 445.73 g/mol, XLogP of 6.67, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4,4-difluoropiperidine;1-tert-butylpiperidine;1-tert-butylpyrrolidine is sourced from PubChem (CID 163717805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).