About cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene
cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene (PubChem CID 163719090) has the molecular formula C14H30CsN2O2-
and a molecular weight of 391.31 g/mol. Its IUPAC name is cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene.
Molecular Properties
| Compound Name | cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene |
| PubChem CID | 163719090 |
| Molecular Formula | C14H30CsN2O2- |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene |
| SMILES | C=CCC[CH2-].[CH2-]COCCNCCOCCNC.[Cs+] |
| InChI | InChI=1S/C9H21N2O2.C5H9.Cs/c1-3-12-8-5-11-6-9-13-7-4-10-2;1-3-5-4-2;/h10-11H,1,3-9H2,2H3;3H,1-2,4-5H2;/q2*-1;+1 |
| InChIKey | NAXXQFVMXUBFNM-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene?
The IUPAC name of cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene (CID 163719090) is cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene.
What is the SMILES notation for cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene?
The canonical SMILES for cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene is C=CCC[CH2-].[CH2-]COCCNCCOCCNC.[Cs+].
What is the InChIKey of cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene?
The InChIKey is NAXXQFVMXUBFNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N2O2.C5H9.Cs/c1-3-12-8-5-11-6-9-13-7-4-10-2;1-3-5-4-2;/h10-11H,1,3-9H2,2H3;3H,1-2,4-5H2;/q2*-1;+1.
What are the key properties of cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene?
cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene has a molecular weight of 391.31 g/mol, XLogP of -1.55, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;2-[2-(2-ethoxyethylamino)ethoxy]-N-methylethanamine;pent-1-ene is sourced from PubChem (CID 163719090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).