C32H42N2O3S — CID 163719569
methyl 2-[2-(2-aminophenyl)-4-(3,4-dimethylphenyl)-5-[[(Z)-ethylidene(methyl)-λ4-sulfanyl]amino]-3,6-dimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 163719569) has the molecular formula C32H42N2O3S and a molecular weight of 534.77 g/mol. Its IUPAC name is methyl 2-[2-(2-aminophenyl)-4-(3,4-dimethylphenyl)-5-[[(Z)-ethylidene(methyl)-λ4-sulfanyl]amino]-3,6-dimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | methyl 2-[2-(2-aminophenyl)-4-(3,4-dimethylphenyl)-5-[[(Z)-ethylidene(methyl)-λ4-sulfanyl]amino]-3,6-dimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 163719569 |
| Molecular Formula | C32H42N2O3S |
| Molecular Weight | 534.77 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | methyl 2-[2-(2-aminophenyl)-4-(3,4-dimethylphenyl)-5-[[(Z)-ethylidene(methyl)-λ4-sulfanyl]amino]-3,6-dimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | C/C=S(/C)Nc1c(C)c(C(OC(C)(C)C)C(=O)OC)c(-c2ccccc2N)c(C)c1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C32H42N2O3S/c1-11-38(10)34-29-22(5)28(30(31(35)36-9)37-32(6,7)8)27(24-14-12-13-15-25(24)33)21(4)26(29)23-17-16-19(2)20(3)18-23/h11-18,30,34H,33H2,1-10H3 |
| InChIKey | KQIOOTSZYKALCY-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.77 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|