C19H23BN2O3 — CID 163719608
2-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethenoxy]aniline (PubChem CID 163719608) has the molecular formula C19H23BN2O3 and a molecular weight of 338.22 g/mol. Its IUPAC name is 2-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethenoxy]aniline.
| Compound Name | 2-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethenoxy]aniline |
|---|---|
| PubChem CID | 163719608 |
| Molecular Formula | C19H23BN2O3 |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]ethenoxy]aniline |
| SMILES | C=C(Oc1ccccc1N)c1cncc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C19H23BN2O3/c1-13(23-17-9-7-6-8-16(17)21)14-10-15(12-22-11-14)20-24-18(2,3)19(4,5)25-20/h6-12H,1,21H2,2-5H3 |
| InChIKey | KQJNVBJDFOCNOT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|