About 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline
3-fluoro-5-propan-2-yl-2,3-dihydroquinoline (PubChem CID 163719688) has the molecular formula C12H14FN
and a molecular weight of 191.25 g/mol. Its IUPAC name is 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline.
Molecular Properties
| Compound Name | 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline |
| PubChem CID | 163719688 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline |
| SMILES | CC(C)c1cccc2c1=CC(F)CN=2 |
| InChI | InChI=1S/C12H14FN/c1-8(2)10-4-3-5-12-11(10)6-9(13)7-14-12/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | KQLQHQKFMOYBLD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline?
The IUPAC name of 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline (CID 163719688) is 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline.
What is the SMILES notation for 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline?
The canonical SMILES for 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline is CC(C)c1cccc2c1=CC(F)CN=2.
What is the InChIKey of 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline?
The InChIKey is KQLQHQKFMOYBLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FN/c1-8(2)10-4-3-5-12-11(10)6-9(13)7-14-12/h3-6,8-9H,7H2,1-2H3.
What are the key properties of 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline?
3-fluoro-5-propan-2-yl-2,3-dihydroquinoline has a molecular weight of 191.25 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5-propan-2-yl-2,3-dihydroquinoline is sourced from PubChem (CID 163719688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).