About 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine
6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine (PubChem CID 163720733) has the molecular formula C16H16BrCl3N2
and a molecular weight of 422.58 g/mol. Its IUPAC name is 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine.
Molecular Properties
| Compound Name | 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine |
| PubChem CID | 163720733 |
| Molecular Formula | C16H16BrCl3N2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine |
| SMILES | CC(C)c1cc(Cc2c(Cl)cc(CCBr)cc2Cl)nnc1Cl |
| InChI | InChI=1S/C16H16BrCl3N2/c1-9(2)12-7-11(21-22-16(12)20)8-13-14(18)5-10(3-4-17)6-15(13)19/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | KRIPLXQZRIESHX-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine?
The IUPAC name of 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine (CID 163720733) is 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine.
What is the SMILES notation for 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine?
The canonical SMILES for 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine is CC(C)c1cc(Cc2c(Cl)cc(CCBr)cc2Cl)nnc1Cl.
What is the InChIKey of 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine?
The InChIKey is KRIPLXQZRIESHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrCl3N2/c1-9(2)12-7-11(21-22-16(12)20)8-13-14(18)5-10(3-4-17)6-15(13)19/h5-7,9H,3-4,8H2,1-2H3.
What are the key properties of 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine?
6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine has a molecular weight of 422.58 g/mol, XLogP of 6.09, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[4-(2-bromoethyl)-2,6-dichlorophenyl]methyl]-3-chloro-4-propan-2-ylpyridazine is sourced from PubChem (CID 163720733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).