About 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine
1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine (PubChem CID 163720851) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine.
Molecular Properties
| Compound Name | 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine |
| PubChem CID | 163720851 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine |
| SMILES | [H]/N=C(\C)C1=CCC(OC(C)(C)C)C=C1 |
| InChI | InChI=1S/C12H19NO/c1-9(13)10-5-7-11(8-6-10)14-12(2,3)4/h5-7,11,13H,8H2,1-4H3/b13-9+ |
| InChIKey | KRKXJDUXJFSYNJ-UKTHLTGXSA-N |
| XLogP | 3.10 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine?
The IUPAC name of 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine (CID 163720851) is 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine.
What is the SMILES notation for 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine?
The canonical SMILES for 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine is [H]/N=C(\C)C1=CCC(OC(C)(C)C)C=C1.
What is the InChIKey of 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine?
The InChIKey is KRKXJDUXJFSYNJ-UKTHLTGXSA-N. The full InChI is InChI=1S/C12H19NO/c1-9(13)10-5-7-11(8-6-10)14-12(2,3)4/h5-7,11,13H,8H2,1-4H3/b13-9+.
What are the key properties of 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine?
1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine has a molecular weight of 193.29 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(2-methylpropan-2-yl)oxy]cyclohexa-1,5-dien-1-yl]ethanimine is sourced from PubChem (CID 163720851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).