About (Z)-3-N-ethylhex-2-ene-2,3-diamine
(Z)-3-N-ethylhex-2-ene-2,3-diamine (PubChem CID 163722683) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is (Z)-3-N-ethylhex-2-ene-2,3-diamine.
Molecular Properties
| Compound Name | (Z)-3-N-ethylhex-2-ene-2,3-diamine |
| PubChem CID | 163722683 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | (Z)-3-N-ethylhex-2-ene-2,3-diamine |
| SMILES | CCC/C(NCC)=C(\C)N |
| InChI | InChI=1S/C8H18N2/c1-4-6-8(7(3)9)10-5-2/h10H,4-6,9H2,1-3H3/b8-7- |
| InChIKey | KSXJYBMQHWQLDV-FPLPWBNLSA-N |
| XLogP | 1.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-3-N-ethylhex-2-ene-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-N-ethylhex-2-ene-2,3-diamine?
The IUPAC name of (Z)-3-N-ethylhex-2-ene-2,3-diamine (CID 163722683) is (Z)-3-N-ethylhex-2-ene-2,3-diamine.
What is the SMILES notation for (Z)-3-N-ethylhex-2-ene-2,3-diamine?
The canonical SMILES for (Z)-3-N-ethylhex-2-ene-2,3-diamine is CCC/C(NCC)=C(\C)N.
What is the InChIKey of (Z)-3-N-ethylhex-2-ene-2,3-diamine?
The InChIKey is KSXJYBMQHWQLDV-FPLPWBNLSA-N. The full InChI is InChI=1S/C8H18N2/c1-4-6-8(7(3)9)10-5-2/h10H,4-6,9H2,1-3H3/b8-7-.
What are the key properties of (Z)-3-N-ethylhex-2-ene-2,3-diamine?
(Z)-3-N-ethylhex-2-ene-2,3-diamine has a molecular weight of 142.25 g/mol, XLogP of 1.59, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-N-ethylhex-2-ene-2,3-diamine is sourced from PubChem (CID 163722683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).