C11H23NOS — CID 163723672
(2S,4R)-2,4-dimethyl-2-propan-2-yl-5-sulfanyl-1,5-oxazocane (PubChem CID 163723672) has the molecular formula C11H23NOS and a molecular weight of 217.38 g/mol. Its IUPAC name is (2S,4R)-2,4-dimethyl-2-propan-2-yl-5-sulfanyl-1,5-oxazocane.
| Compound Name | (2S,4R)-2,4-dimethyl-2-propan-2-yl-5-sulfanyl-1,5-oxazocane |
|---|---|
| PubChem CID | 163723672 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (2S,4R)-2,4-dimethyl-2-propan-2-yl-5-sulfanyl-1,5-oxazocane |
| SMILES | CC(C)[C@]1(C)C[C@@H](C)N(S)CCCO1 |
| InChI | InChI=1S/C11H23NOS/c1-9(2)11(4)8-10(3)12(14)6-5-7-13-11/h9-10,14H,5-8H2,1-4H3/t10-,11+/m1/s1 |
| InChIKey | KTTVUJFOXYLYSV-MNOVXSKESA-N |
| XLogP | 2.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|