C11H21N5 — CID 163725103
6-(3-methylbutan-2-yl)benzene-1,2,3,4,5-pentamine (PubChem CID 163725103) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 6-(3-methylbutan-2-yl)benzene-1,2,3,4,5-pentamine.
| Compound Name | 6-(3-methylbutan-2-yl)benzene-1,2,3,4,5-pentamine |
|---|---|
| PubChem CID | 163725103 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 6-(3-methylbutan-2-yl)benzene-1,2,3,4,5-pentamine |
| SMILES | CC(C)C(C)c1c(N)c(N)c(N)c(N)c1N |
| InChI | InChI=1S/C11H21N5/c1-4(2)5(3)6-7(12)9(14)11(16)10(15)8(6)13/h4-5H,12-16H2,1-3H3 |
| InChIKey | KUWWDQJIVOLUTH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|