C8H8N2O4 — CID 163725944
2,5-dimethyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-1,3,4,6-tetrone (PubChem CID 163725944) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is 2,5-dimethyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-1,3,4,6-tetrone.
| Compound Name | 2,5-dimethyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-1,3,4,6-tetrone |
|---|---|
| PubChem CID | 163725944 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 2,5-dimethyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-1,3,4,6-tetrone |
| SMILES | CN1C(=O)C2C(=O)N(C)C(=O)C2C1=O |
| InChI | InChI=1S/C8H8N2O4/c1-9-5(11)3-4(6(9)12)8(14)10(2)7(3)13/h3-4H,1-2H3 |
| InChIKey | KVOOYUHYWLMLBT-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|