C23H26N4O4S — CID 163726126
4-methyl-3-[4-(2-methyl-1H-indol-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]-1-oxa-4λ6-thiacyclohex-3-ene 4-oxide (PubChem CID 163726126) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 4-methyl-3-[4-(2-methyl-1H-indol-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]-1-oxa-4λ6-thiacyclohex-3-ene 4-oxide.
| Compound Name | 4-methyl-3-[4-(2-methyl-1H-indol-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]-1-oxa-4λ6-thiacyclohex-3-ene 4-oxide |
|---|---|
| PubChem CID | 163726126 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 4-methyl-3-[4-(2-methyl-1H-indol-4-yl)-8,12-dioxa-1,3,5-triazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-6-yl]-1-oxa-4λ6-thiacyclohex-3-ene 4-oxide |
| SMILES | Cc1cc2c(-c3nc(C4=S(C)(=O)CCOC4)c4c(n3)N3CCOCC3CO4)cccc2[nH]1 |
| InChI | InChI=1S/C23H26N4O4S/c1-14-10-17-16(4-3-5-18(17)24-14)22-25-20(19-13-30-8-9-32(19,2)28)21-23(26-22)27-6-7-29-11-15(27)12-31-21/h3-5,10,15,24H,6-9,11-13H2,1-2H3 |
| InChIKey | KVSHYTRDKLGZLT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|