C15H23N — CID 163726327
4-[(1Z)-2,3-dimethylbuta-1,3-dienyl]-5-[(Z)-prop-1-enyl]-2,3,6,7-tetrahydro-1H-azepine (PubChem CID 163726327) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 4-[(1Z)-2,3-dimethylbuta-1,3-dienyl]-5-[(Z)-prop-1-enyl]-2,3,6,7-tetrahydro-1H-azepine.
| Compound Name | 4-[(1Z)-2,3-dimethylbuta-1,3-dienyl]-5-[(Z)-prop-1-enyl]-2,3,6,7-tetrahydro-1H-azepine |
|---|---|
| PubChem CID | 163726327 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 4-[(1Z)-2,3-dimethylbuta-1,3-dienyl]-5-[(Z)-prop-1-enyl]-2,3,6,7-tetrahydro-1H-azepine |
| SMILES | C=C(C)/C(C)=C\C1=C(/C=C\C)CCNCC1 |
| InChI | InChI=1S/C15H23N/c1-5-6-14-7-9-16-10-8-15(14)11-13(4)12(2)3/h5-6,11,16H,2,7-10H2,1,3-4H3/b6-5-,13-11- |
| InChIKey | KVXDWMYOGNHLQX-VNWVSWPHSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|