C15H19IN4O3 — CID 163726716
N-(diaminomethylidene)-4-(1-iodopropan-2-yl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxamide (PubChem CID 163726716) has the molecular formula C15H19IN4O3 and a molecular weight of 430.25 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-(1-iodopropan-2-yl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxamide.
| Compound Name | N-(diaminomethylidene)-4-(1-iodopropan-2-yl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 163726716 |
| Molecular Formula | C15H19IN4O3 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-(diaminomethylidene)-4-(1-iodopropan-2-yl)-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxamide |
| SMILES | CC(CI)N1C(=O)C(C)(C)Oc2ccc(C(=O)N=C(N)N)cc21 |
| InChI | InChI=1S/C15H19IN4O3/c1-8(7-16)20-10-6-9(12(21)19-14(17)18)4-5-11(10)23-15(2,3)13(20)22/h4-6,8H,7H2,1-3H3,(H4,17,18,19,21) |
| InChIKey | KWFOKZHUOICVFT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|