About 4-isocyanatobutyl 2-methylpropanoate
4-isocyanatobutyl 2-methylpropanoate (PubChem CID 163727175) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 4-isocyanatobutyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 4-isocyanatobutyl 2-methylpropanoate |
| PubChem CID | 163727175 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 4-isocyanatobutyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCCCN=C=O |
| InChI | InChI=1S/C9H15NO3/c1-8(2)9(12)13-6-4-3-5-10-7-11/h8H,3-6H2,1-2H3 |
| InChIKey | KWOZRLRDGXXGSR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyanatobutyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyanatobutyl 2-methylpropanoate?
The IUPAC name of 4-isocyanatobutyl 2-methylpropanoate (CID 163727175) is 4-isocyanatobutyl 2-methylpropanoate.
What is the SMILES notation for 4-isocyanatobutyl 2-methylpropanoate?
The canonical SMILES for 4-isocyanatobutyl 2-methylpropanoate is CC(C)C(=O)OCCCCN=C=O.
What is the InChIKey of 4-isocyanatobutyl 2-methylpropanoate?
The InChIKey is KWOZRLRDGXXGSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-8(2)9(12)13-6-4-3-5-10-7-11/h8H,3-6H2,1-2H3.
What are the key properties of 4-isocyanatobutyl 2-methylpropanoate?
4-isocyanatobutyl 2-methylpropanoate has a molecular weight of 185.22 g/mol, XLogP of 1.30, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyanatobutyl 2-methylpropanoate is sourced from PubChem (CID 163727175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).