C52H36N2 — CID 163727433
N-phenyl-N-[4-[2,3,5,6-tetradeuterio-4-[2,3,5,6-tetradeuterio-4-(N-phenylanilino)phenyl]phenyl]phenyl]pyren-4-amine (PubChem CID 163727433) has the molecular formula C52H36N2 and a molecular weight of 696.92 g/mol. Its IUPAC name is N-phenyl-N-[4-[2,3,5,6-tetradeuterio-4-[2,3,5,6-tetradeuterio-4-(N-phenylanilino)phenyl]phenyl]phenyl]pyren-4-amine.
| Compound Name | N-phenyl-N-[4-[2,3,5,6-tetradeuterio-4-[2,3,5,6-tetradeuterio-4-(N-phenylanilino)phenyl]phenyl]phenyl]pyren-4-amine |
|---|---|
| PubChem CID | 163727433 |
| Molecular Formula | C52H36N2 |
| Molecular Weight | 696.92 g/mol |
| Exact Mass | 696.34 |
| IUPAC Name | N-phenyl-N-[4-[2,3,5,6-tetradeuterio-4-[2,3,5,6-tetradeuterio-4-(N-phenylanilino)phenyl]phenyl]phenyl]pyren-4-amine |
| SMILES | [2H]c1c([2H])c(-c2c([2H])c([2H])c(N(c3ccccc3)c3ccccc3)c([2H])c2[2H])c([2H])c([2H])c1-c1ccc(N(c2ccccc2)c2cc3cccc4ccc5cccc2c5c43)cc1 |
| InChI | InChI=1S/C52H36N2/c1-4-15-44(16-5-1)53(45-17-6-2-7-18-45)47-32-28-39(29-33-47)37-22-24-38(25-23-37)40-30-34-48(35-31-40)54(46-19-8-3-9-20-46)50-36-43-14-10-12-41-26-27-42-13-11-21-49(50)52(42)51(41)43/h1-36H/i22D,23D,24D,25D,28D,29D,32D,33D |
| InChIKey | KMHAEDCUOJSOIR-AYYWYUAVSA-N |
| XLogP | 14.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.92 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|