C15H24F4O4 — CID 163727605
[3,3,5,5-tetrafluoro-1-[2-(oxan-4-yl)ethoxy]hexan-2-yl] acetate (PubChem CID 163727605) has the molecular formula C15H24F4O4 and a molecular weight of 344.35 g/mol. Its IUPAC name is [3,3,5,5-tetrafluoro-1-[2-(oxan-4-yl)ethoxy]hexan-2-yl] acetate.
| Compound Name | [3,3,5,5-tetrafluoro-1-[2-(oxan-4-yl)ethoxy]hexan-2-yl] acetate |
|---|---|
| PubChem CID | 163727605 |
| Molecular Formula | C15H24F4O4 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [3,3,5,5-tetrafluoro-1-[2-(oxan-4-yl)ethoxy]hexan-2-yl] acetate |
| SMILES | CC(=O)OC(COCCC1CCOCC1)C(F)(F)CC(C)(F)F |
| InChI | InChI=1S/C15H24F4O4/c1-11(20)23-13(15(18,19)10-14(2,16)17)9-22-8-5-12-3-6-21-7-4-12/h12-13H,3-10H2,1-2H3 |
| InChIKey | IZCDFTLGTKZCCL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|