C19H4F8N4 — CID 163727824
(2E)-2-[(8Z)-8-[cyano-(2,3,4,5,6-pentafluorophenyl)methylidene]quinoxalin-5-ylidene]-3,3,3-trifluoropropanenitrile (PubChem CID 163727824) has the molecular formula C19H4F8N4 and a molecular weight of 440.25 g/mol. Its IUPAC name is (2E)-2-[(8Z)-8-[cyano-(2,3,4,5,6-pentafluorophenyl)methylidene]quinoxalin-5-ylidene]-3,3,3-trifluoropropanenitrile.
| Compound Name | (2E)-2-[(8Z)-8-[cyano-(2,3,4,5,6-pentafluorophenyl)methylidene]quinoxalin-5-ylidene]-3,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 163727824 |
| Molecular Formula | C19H4F8N4 |
| Molecular Weight | 440.25 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | (2E)-2-[(8Z)-8-[cyano-(2,3,4,5,6-pentafluorophenyl)methylidene]quinoxalin-5-ylidene]-3,3,3-trifluoropropanenitrile |
| SMILES | N#C/C(c1c(F)c(F)c(F)c(F)c1F)=c1/cc/c(=C(/C#N)C(F)(F)F)c2nccnc12 |
| InChI | InChI=1S/C19H4F8N4/c20-12-11(13(21)15(23)16(24)14(12)22)9(5-28)7-1-2-8(10(6-29)19(25,26)27)18-17(7)30-3-4-31-18/h1-4H/b9-7+,10-8+ |
| InChIKey | KXCFGKOYOZCGHH-FIFLTTCUSA-N |
| XLogP | 3.28 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|