C15H21BN2O2 — CID 163728574
N'-methyl-N-methylidene-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide (PubChem CID 163728574) has the molecular formula C15H21BN2O2 and a molecular weight of 272.16 g/mol. Its IUPAC name is N'-methyl-N-methylidene-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide.
| Compound Name | N'-methyl-N-methylidene-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 163728574 |
| Molecular Formula | C15H21BN2O2 |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N'-methyl-N-methylidene-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide |
| SMILES | C=N/C(=N\C)c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C15H21BN2O2/c1-14(2)15(3,4)20-16(19-14)12-9-7-8-11(10-12)13(17-5)18-6/h7-10H,5H2,1-4,6H3/b18-13- |
| InChIKey | KXRDOSITQGFXHN-AQTBWJFISA-N |
| XLogP | 2.06 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|