About 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone
1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone (PubChem CID 163728641) has the molecular formula C8H11IO
and a molecular weight of 250.08 g/mol. Its IUPAC name is 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone |
| PubChem CID | 163728641 |
| Molecular Formula | C8H11IO |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone |
| SMILES | C=C1C(C(C)=O)=ICC1C |
| InChI | InChI=1S/C8H11IO/c1-5-4-9-8(6(5)2)7(3)10/h5H,2,4H2,1,3H3 |
| InChIKey | KXSNHKBUYGLUHW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone?
The IUPAC name of 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone (CID 163728641) is 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone.
What is the SMILES notation for 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone?
The canonical SMILES for 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone is C=C1C(C(C)=O)=ICC1C.
What is the InChIKey of 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone?
The InChIKey is KXSNHKBUYGLUHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11IO/c1-5-4-9-8(6(5)2)7(3)10/h5H,2,4H2,1,3H3.
What are the key properties of 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone?
1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone has a molecular weight of 250.08 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-3-methylidene-1λ3-iodacyclopenten-2-yl)ethanone is sourced from PubChem (CID 163728641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).