About S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine
S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine (PubChem CID 163728660) has the molecular formula C6H15NS
and a molecular weight of 133.26 g/mol. Its IUPAC name is S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine.
Molecular Properties
| Compound Name | S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine |
| PubChem CID | 163728660 |
| Molecular Formula | C6H15NS |
| Molecular Weight | 133.26 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine |
| SMILES | CC(C)[C@@H](C)CSN |
| InChI | InChI=1S/C6H15NS/c1-5(2)6(3)4-8-7/h5-6H,4,7H2,1-3H3/t6-/m0/s1 |
| InChIKey | KXSUOQRCYHKCLA-LURJTMIESA-N |
| XLogP | 1.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine?
The IUPAC name of S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine (CID 163728660) is S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine.
What is the SMILES notation for S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine?
The canonical SMILES for S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine is CC(C)[C@@H](C)CSN.
What is the InChIKey of S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine?
The InChIKey is KXSUOQRCYHKCLA-LURJTMIESA-N. The full InChI is InChI=1S/C6H15NS/c1-5(2)6(3)4-8-7/h5-6H,4,7H2,1-3H3/t6-/m0/s1.
What are the key properties of S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine?
S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine has a molecular weight of 133.26 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2R)-2,3-dimethylbutyl]thiohydroxylamine is sourced from PubChem (CID 163728660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).