C11H19N — CID 163728882
(2S,3S)-2-ethenyl-2,3,4,4-tetramethylpentanenitrile (PubChem CID 163728882) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (2S,3S)-2-ethenyl-2,3,4,4-tetramethylpentanenitrile.
| Compound Name | (2S,3S)-2-ethenyl-2,3,4,4-tetramethylpentanenitrile |
|---|---|
| PubChem CID | 163728882 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (2S,3S)-2-ethenyl-2,3,4,4-tetramethylpentanenitrile |
| SMILES | C=C[C@](C)(C#N)[C@@H](C)C(C)(C)C |
| InChI | InChI=1S/C11H19N/c1-7-11(6,8-12)9(2)10(3,4)5/h7,9H,1H2,2-6H3/t9-,11+/m0/s1 |
| InChIKey | KXXASPPUVSQONH-GXSJLCMTSA-N |
| XLogP | 3.38 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|