About 3-iodofuro[2,3-d][1,2]thiazole
3-iodofuro[2,3-d][1,2]thiazole (PubChem CID 163729445) has the molecular formula C5H2INOS
and a molecular weight of 251.05 g/mol. Its IUPAC name is 3-iodofuro[2,3-d][1,2]thiazole.
Molecular Properties
| Compound Name | 3-iodofuro[2,3-d][1,2]thiazole |
| PubChem CID | 163729445 |
| Molecular Formula | C5H2INOS |
| Molecular Weight | 251.05 g/mol |
| Exact Mass | 250.89 |
| IUPAC Name | 3-iodofuro[2,3-d][1,2]thiazole |
| SMILES | Ic1nsc2ccoc12 |
| InChI | InChI=1S/C5H2INOS/c6-5-4-3(9-7-5)1-2-8-4/h1-2H |
| InChIKey | KYIGZDAHBKHSED-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.05 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodofuro[2,3-d][1,2]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodofuro[2,3-d][1,2]thiazole?
The IUPAC name of 3-iodofuro[2,3-d][1,2]thiazole (CID 163729445) is 3-iodofuro[2,3-d][1,2]thiazole.
What is the SMILES notation for 3-iodofuro[2,3-d][1,2]thiazole?
The canonical SMILES for 3-iodofuro[2,3-d][1,2]thiazole is Ic1nsc2ccoc12.
What is the InChIKey of 3-iodofuro[2,3-d][1,2]thiazole?
The InChIKey is KYIGZDAHBKHSED-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2INOS/c6-5-4-3(9-7-5)1-2-8-4/h1-2H.
What are the key properties of 3-iodofuro[2,3-d][1,2]thiazole?
3-iodofuro[2,3-d][1,2]thiazole has a molecular weight of 251.05 g/mol, XLogP of 2.49, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodofuro[2,3-d][1,2]thiazole is sourced from PubChem (CID 163729445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).