About 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one
2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one (PubChem CID 163729895) has the molecular formula C15H14O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one |
| PubChem CID | 163729895 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(C2=CC=CCC2)Oc2ccccc21 |
| InChI | InChI=1S/C15H14O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-2,4-6,8-9,15H,3,7,10H2 |
| InChIKey | KYSKEUCHDBAWTN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one?
The IUPAC name of 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one (CID 163729895) is 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one?
The canonical SMILES for 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one is O=C1CC(C2=CC=CCC2)Oc2ccccc21.
What is the InChIKey of 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one?
The InChIKey is KYSKEUCHDBAWTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-2,4-6,8-9,15H,3,7,10H2.
What are the key properties of 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one?
2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one has a molecular weight of 226.28 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,3-dien-1-yl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 163729895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).