About 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole
3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole (PubChem CID 163730614) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole.
Molecular Properties
| Compound Name | 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole |
| PubChem CID | 163730614 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole |
| SMILES | CN1C=CNC1C1CCCN1 |
| InChI | InChI=1S/C8H15N3/c1-11-6-5-10-8(11)7-3-2-4-9-7/h5-10H,2-4H2,1H3 |
| InChIKey | KZFTYNYRBPPAOD-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole?
The IUPAC name of 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole (CID 163730614) is 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole.
What is the SMILES notation for 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole?
The canonical SMILES for 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole is CN1C=CNC1C1CCCN1.
What is the InChIKey of 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole?
The InChIKey is KZFTYNYRBPPAOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-11-6-5-10-8(11)7-3-2-4-9-7/h5-10H,2-4H2,1H3.
What are the key properties of 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole?
3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole has a molecular weight of 153.23 g/mol, XLogP of 0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-pyrrolidin-2-yl-1,2-dihydroimidazole is sourced from PubChem (CID 163730614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).