C37H48FN5O6Si — CID 163730766
CID 163730766 (PubChem CID 163730766) has the molecular formula C37H48FN5O6Si and a molecular weight of 705.90 g/mol.
| Compound Name | CID 163730766 |
|---|---|
| PubChem CID | 163730766 |
| Molecular Formula | C37H48FN5O6Si |
| Molecular Weight | 705.90 g/mol |
| Exact Mass | 705.34 |
| IUPAC Name | — |
| SMILES | CCC(=O)N[C@@H](C(=O)N1CCN(C)CC1)[C@@H](C)c1ccc(NC(=O)[C@@](NC(=O)c2coc3cc(OC)ccc23)([Si]C)C2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C37H48FN5O6Si/c1-6-32(44)40-33(35(46)43-18-16-42(3)17-19-43)23(2)24-12-15-30(29(38)20-24)39-36(47)37(50-5,25-10-8-7-9-11-25)41-34(45)28-22-49-31-21-26(48-4)13-14-27(28)31/h12-15,20-23,25,33H,6-11,16-19H2,1-5H3,(H,39,47)(H,40,44)(H,41,45)/t23-,33+,37-/m0/s1 |
| InChIKey | BQPRMLUKPBLXGH-ZIBZMAJCSA-N |
| XLogP | 4.75 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.90 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|