C20H36O — CID 163731043
(2R)-8-ethyl-7-methyl-2-propyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-ol (PubChem CID 163731043) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is (2R)-8-ethyl-7-methyl-2-propyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-ol.
| Compound Name | (2R)-8-ethyl-7-methyl-2-propyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-ol |
|---|---|
| PubChem CID | 163731043 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | (2R)-8-ethyl-7-methyl-2-propyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-1H-phenanthren-2-ol |
| SMILES | CCC[C@@]1(O)CCC2C(CCC3C(CC)C(C)CCC23)C1 |
| InChI | InChI=1S/C20H36O/c1-4-11-20(21)12-10-17-15(13-20)7-9-18-16(5-2)14(3)6-8-19(17)18/h14-19,21H,4-13H2,1-3H3/t14?,15?,16?,17?,18?,19?,20-/m1/s1 |
| InChIKey | KZOFZURRLKCPBO-SXVGOASOSA-N |
| XLogP | 5.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |