C8H10F5NO3 — CID 163731205
trans-(1R,6R)-2,2-difluoro-6-hydroxy-N-(2,2,2-trifluoroacetyl)cyclohexan-1-amine oxide (PubChem CID 163731205) has the molecular formula C8H10F5NO3 and a molecular weight of 263.16 g/mol. Its IUPAC name is trans-(1R,6R)-2,2-difluoro-6-hydroxy-N-(2,2,2-trifluoroacetyl)cyclohexan-1-amine oxide.
| Compound Name | trans-(1R,6R)-2,2-difluoro-6-hydroxy-N-(2,2,2-trifluoroacetyl)cyclohexan-1-amine oxide |
|---|---|
| PubChem CID | 163731205 |
| Molecular Formula | C8H10F5NO3 |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | trans-(1R,6R)-2,2-difluoro-6-hydroxy-N-(2,2,2-trifluoroacetyl)cyclohexan-1-amine oxide |
| SMILES | O=C([NH+]([O-])[C@@H]1[C@H](O)CCCC1(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10F5NO3/c9-7(10)3-1-2-4(15)5(7)14(17)6(16)8(11,12)13/h4-5,14-15H,1-3H2/t4-,5-/m1/s1 |
| InChIKey | KZRTVURHNCETOC-RFZPGFLSSA-N |
| XLogP | 0.01 |
| TPSA | 64.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|