C36H46FN3O4 — CID 163732587
(3S)-3-[(1R)-2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-10-propyl-6-prop-2-ynyl-15-oxa-4,10-diazatricyclo[14.3.1.06,8]icosa-1(20),16,18-triene-5,9-dione (PubChem CID 163732587) has the molecular formula C36H46FN3O4 and a molecular weight of 603.78 g/mol. Its IUPAC name is (3S)-3-[(1R)-2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-10-propyl-6-prop-2-ynyl-15-oxa-4,10-diazatricyclo[14.3.1.06,8]icosa-1(20),16,18-triene-5,9-dione.
| Compound Name | (3S)-3-[(1R)-2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-10-propyl-6-prop-2-ynyl-15-oxa-4,10-diazatricyclo[14.3.1.06,8]icosa-1(20),16,18-triene-5,9-dione |
|---|---|
| PubChem CID | 163732587 |
| Molecular Formula | C36H46FN3O4 |
| Molecular Weight | 603.78 g/mol |
| Exact Mass | 603.35 |
| IUPAC Name | (3S)-3-[(1R)-2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-10-propyl-6-prop-2-ynyl-15-oxa-4,10-diazatricyclo[14.3.1.06,8]icosa-1(20),16,18-triene-5,9-dione |
| SMILES | C#CCC12CC1C(=O)N(CCC)CCCCOc1cc(F)cc(c1)C[C@@H]([C@H](O)CNC1(c3cccc(CC)c3)CC1)NC2=O |
| InChI | InChI=1S/C36H46FN3O4/c1-4-12-35-23-30(35)33(42)40(15-5-2)16-7-8-17-44-29-20-26(19-28(37)22-29)21-31(39-34(35)43)32(41)24-38-36(13-14-36)27-11-9-10-25(6-3)18-27/h1,9-11,18-20,22,30-32,38,41H,5-8,12-17,21,23-24H2,2-3H3,(H,39,43)/t30?,31-,32+,35?/m0/s1 |
| InChIKey | LAVYOZPGHDZBRR-LJPLEICMSA-N |
| XLogP | 4.50 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.78 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|