About N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde
N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde (PubChem CID 163733055) has the molecular formula C43H39N3O2
and a molecular weight of 629.80 g/mol. Its IUPAC name is N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde.
Molecular Properties
| Compound Name | N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde |
| PubChem CID | 163733055 |
| Molecular Formula | C43H39N3O2 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.30 |
| IUPAC Name | N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde |
| SMILES | C(/C=N/C(c1ccccc1)c1ccccc1)=N\C(c1ccccc1)c1ccccc1.NC(c1ccccc1)c1ccccc1.O=CC=O |
| InChI | InChI=1S/C28H24N2.C13H13N.C2H2O2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)29-21-22-30-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;3-1-2-4/h1-22,27-28H;1-10,13H,14H2;1-2H/b29-21+,30-22+;; |
| InChIKey | LBGIPHWZZCZBMN-HEVKTJNJSA-N |
| XLogP | 8.83 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde?
The IUPAC name of N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde (CID 163733055) is N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde.
What is the SMILES notation for N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde?
The canonical SMILES for N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde is C(/C=N/C(c1ccccc1)c1ccccc1)=N\C(c1ccccc1)c1ccccc1.NC(c1ccccc1)c1ccccc1.O=CC=O.
What is the InChIKey of N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde?
The InChIKey is LBGIPHWZZCZBMN-HEVKTJNJSA-N. The full InChI is InChI=1S/C28H24N2.C13H13N.C2H2O2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)29-21-22-30-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;3-1-2-4/h1-22,27-28H;1-10,13H,14H2;1-2H/b29-21+,30-22+;;.
What are the key properties of N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde?
N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde has a molecular weight of 629.80 g/mol, XLogP of 8.83, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dibenzhydrylethane-1,2-diimine;diphenylmethanamine;oxaldehyde is sourced from PubChem (CID 163733055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).